C14H18N4OS — CID 110397912
1-benzyl-3-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]urea (PubChem CID 110397912) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 1-benzyl-3-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]urea.
| Compound Name | 1-benzyl-3-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]urea |
|---|---|
| PubChem CID | 110397912 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 1-benzyl-3-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]urea |
| SMILES | CNc1nc(CCNC(=O)NCc2ccccc2)cs1 |
| InChI | InChI=1S/C14H18N4OS/c1-15-14-18-12(10-20-14)7-8-16-13(19)17-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,15,18)(H2,16,17,19) |
| InChIKey | SOWOYRZNMGRSLE-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |