C13H16N4OS — CID 110397891
1-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-3-phenylurea (PubChem CID 110397891) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 1-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-3-phenylurea.
| Compound Name | 1-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-3-phenylurea |
|---|---|
| PubChem CID | 110397891 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-3-phenylurea |
| SMILES | CNc1nc(CCNC(=O)Nc2ccccc2)cs1 |
| InChI | InChI=1S/C13H16N4OS/c1-14-13-17-11(9-19-13)7-8-15-12(18)16-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,14,17)(H2,15,16,18) |
| InChIKey | VMAMUAYOPRLNJL-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |