C20H21N3OS — CID 110397867
N-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-2,2-diphenylacetamide (PubChem CID 110397867) has the molecular formula C20H21N3OS and a molecular weight of 351.48 g/mol. Its IUPAC name is N-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 110397867 |
| Molecular Formula | C20H21N3OS |
| Molecular Weight | 351.48 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | N-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethyl]-2,2-diphenylacetamide |
| SMILES | CNc1nc(CCNC(=O)C(c2ccccc2)c2ccccc2)cs1 |
| InChI | InChI=1S/C20H21N3OS/c1-21-20-23-17(14-25-20)12-13-22-19(24)18(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-11,14,18H,12-13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | FPCFMGZPRFKTNK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.48 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |