C26H24N2O2S — CID 39071719
N-[2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethyl]-2,2-diphenylacetamide (PubChem CID 39071719) has the molecular formula C26H24N2O2S and a molecular weight of 428.56 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethyl]-2,2-diphenylacetamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 39071719 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]ethyl]-2,2-diphenylacetamide |
| SMILES | COc1ccc(-c2csc(CCNC(=O)C(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H24N2O2S/c1-30-22-14-12-19(13-15-22)23-18-31-24(28-23)16-17-27-26(29)25(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,18,25H,16-17H2,1H3,(H,27,29) |
| InChIKey | UAXPADUCHPBCMS-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |