C18H24N2O3S — CID 110418857
3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(2-propan-2-yloxyethyl)propanamide (PubChem CID 110418857) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(2-propan-2-yloxyethyl)propanamide.
| Compound Name | 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(2-propan-2-yloxyethyl)propanamide |
|---|---|
| PubChem CID | 110418857 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 3-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-N-(2-propan-2-yloxyethyl)propanamide |
| SMILES | COc1ccc(-c2csc(CCC(=O)NCCOC(C)C)n2)cc1 |
| InChI | InChI=1S/C18H24N2O3S/c1-13(2)23-11-10-19-17(21)8-9-18-20-16(12-24-18)14-4-6-15(22-3)7-5-14/h4-7,12-13H,8-11H2,1-3H3,(H,19,21) |
| InChIKey | XCXQGLVHDCVEQQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|