C13H15N3O4S2 — CID 110719686
4-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethylsulfamoyl]benzoic acid (PubChem CID 110719686) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethylsulfamoyl]benzoic acid.
| Compound Name | 4-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 110719686 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 4-[2-[2-(methylamino)-1,3-thiazol-4-yl]ethylsulfamoyl]benzoic acid |
| SMILES | CNc1nc(CCNS(=O)(=O)c2ccc(C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C13H15N3O4S2/c1-14-13-16-10(8-21-13)6-7-15-22(19,20)11-4-2-9(3-5-11)12(17)18/h2-5,8,15H,6-7H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | VBBWJDGYWQOMIG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |