C14H16N2O4S2 — CID 166178742
4-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoylmethyl]benzoic acid (PubChem CID 166178742) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 4-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoylmethyl]benzoic acid.
| Compound Name | 4-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoylmethyl]benzoic acid |
|---|---|
| PubChem CID | 166178742 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 4-[2-(2-methyl-1,3-thiazol-4-yl)ethylsulfamoylmethyl]benzoic acid |
| SMILES | Cc1nc(CCNS(=O)(=O)Cc2ccc(C(=O)O)cc2)cs1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-10-16-13(8-21-10)6-7-15-22(19,20)9-11-2-4-12(5-3-11)14(17)18/h2-5,8,15H,6-7,9H2,1H3,(H,17,18) |
| InChIKey | GALRJROBTDAMFR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |