4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid

C12H12N2O2S — CID 43139161

IUPAC4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid
SMILESCc1nc(CNc2ccc(C(=O)O)cc2)cs1
InChIInChI=1S/C12H12N2O2S/c1-8-14-11(7-17-8)6-13-10-4-2-9(3-5-10)12(15)16/h2-5,7,13H,6H2,1H3,(H,15,16)
InChIKeyZWCUTOQJOBQMMI-UHFFFAOYSA-N
MW248.31 g/mol
LogP2.76
Rot. Bonds4

About 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid

4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid (PubChem CID 43139161) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid.

Molecular Properties

Compound Name4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid
PubChem CID43139161
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid
SMILESCc1nc(CNc2ccc(C(=O)O)cc2)cs1
InChIInChI=1S/C12H12N2O2S/c1-8-14-11(7-17-8)6-13-10-4-2-9(3-5-10)12(15)16/h2-5,7,13H,6H2,1H3,(H,15,16)
InChIKeyZWCUTOQJOBQMMI-UHFFFAOYSA-N
XLogP2.76
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 52.76
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid?
The IUPAC name of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid (CID 43139161) is 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid.
What is the SMILES notation for 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid?
The canonical SMILES for 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid is Cc1nc(CNc2ccc(C(=O)O)cc2)cs1.
What is the InChIKey of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid?
The InChIKey is ZWCUTOQJOBQMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-8-14-11(7-17-8)6-13-10-4-2-9(3-5-10)12(15)16/h2-5,7,13H,6H2,1H3,(H,15,16).
What are the key properties of 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid?
4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid has a molecular weight of 248.31 g/mol, XLogP of 2.76, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzoic acid is sourced from PubChem (CID 43139161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).