C12H12N2O2S — CID 60941885
4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzoic acid (PubChem CID 60941885) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzoic acid.
| Compound Name | 4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 60941885 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzoic acid |
| SMILES | Cc1ncc(CNc2ccc(C(=O)O)cc2)s1 |
| InChI | InChI=1S/C12H12N2O2S/c1-8-13-6-11(17-8)7-14-10-4-2-9(3-5-10)12(15)16/h2-6,14H,7H2,1H3,(H,15,16) |
| InChIKey | DJNBKDSYQSKBFX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |