C12H11BrN2O4S2 — CID 61281998
3-bromo-4-[(2-methyl-1,3-thiazol-5-yl)methylsulfamoyl]benzoic acid (PubChem CID 61281998) has the molecular formula C12H11BrN2O4S2 and a molecular weight of 391.27 g/mol. Its IUPAC name is 3-bromo-4-[(2-methyl-1,3-thiazol-5-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 3-bromo-4-[(2-methyl-1,3-thiazol-5-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 61281998 |
| Molecular Formula | C12H11BrN2O4S2 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 389.93 |
| IUPAC Name | 3-bromo-4-[(2-methyl-1,3-thiazol-5-yl)methylsulfamoyl]benzoic acid |
| SMILES | Cc1ncc(CNS(=O)(=O)c2ccc(C(=O)O)cc2Br)s1 |
| InChI | InChI=1S/C12H11BrN2O4S2/c1-7-14-5-9(20-7)6-15-21(18,19)11-3-2-8(12(16)17)4-10(11)13/h2-5,15H,6H2,1H3,(H,16,17) |
| InChIKey | BXCKHGZDJQKAJW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |