C10H10BrNO6S — CID 28540514
3-bromo-4-[(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid (PubChem CID 28540514) has the molecular formula C10H10BrNO6S and a molecular weight of 352.16 g/mol. Its IUPAC name is 3-bromo-4-[(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid.
| Compound Name | 3-bromo-4-[(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 28540514 |
| Molecular Formula | C10H10BrNO6S |
| Molecular Weight | 352.16 g/mol |
| Exact Mass | 350.94 |
| IUPAC Name | 3-bromo-4-[(2-methoxy-2-oxoethyl)sulfamoyl]benzoic acid |
| SMILES | COC(=O)CNS(=O)(=O)c1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C10H10BrNO6S/c1-18-9(13)5-12-19(16,17)8-3-2-6(10(14)15)4-7(8)11/h2-4,12H,5H2,1H3,(H,14,15) |
| InChIKey | RQMNLXNYACKUPT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.16 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |