C10H11BrN2O6S — CID 83201896
3-bromo-4-(2-carbamoyloxyethylsulfamoyl)benzoic acid (PubChem CID 83201896) has the molecular formula C10H11BrN2O6S and a molecular weight of 367.18 g/mol. Its IUPAC name is 3-bromo-4-(2-carbamoyloxyethylsulfamoyl)benzoic acid.
| Compound Name | 3-bromo-4-(2-carbamoyloxyethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 83201896 |
| Molecular Formula | C10H11BrN2O6S |
| Molecular Weight | 367.18 g/mol |
| Exact Mass | 365.95 |
| IUPAC Name | 3-bromo-4-(2-carbamoyloxyethylsulfamoyl)benzoic acid |
| SMILES | NC(=O)OCCNS(=O)(=O)c1ccc(C(=O)O)cc1Br |
| InChI | InChI=1S/C10H11BrN2O6S/c11-7-5-6(9(14)15)1-2-8(7)20(17,18)13-3-4-19-10(12)16/h1-2,5,13H,3-4H2,(H2,12,16)(H,14,15) |
| InChIKey | VPIFPEULWITJEV-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|