C13H12BrNO4S2 — CID 61473152
3-bromo-4-(2-thiophen-3-ylethylsulfamoyl)benzoic acid (PubChem CID 61473152) has the molecular formula C13H12BrNO4S2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 3-bromo-4-(2-thiophen-3-ylethylsulfamoyl)benzoic acid.
| Compound Name | 3-bromo-4-(2-thiophen-3-ylethylsulfamoyl)benzoic acid |
|---|---|
| PubChem CID | 61473152 |
| Molecular Formula | C13H12BrNO4S2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 388.94 |
| IUPAC Name | 3-bromo-4-(2-thiophen-3-ylethylsulfamoyl)benzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)NCCc2ccsc2)c(Br)c1 |
| InChI | InChI=1S/C13H12BrNO4S2/c14-11-7-10(13(16)17)1-2-12(11)21(18,19)15-5-3-9-4-6-20-8-9/h1-2,4,6-8,15H,3,5H2,(H,16,17) |
| InChIKey | RPJYYQBCEDRIQP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |