C13H15BrN2O2S2 — CID 114379338
3-amino-5-bromo-2-methyl-N-(2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 114379338) has the molecular formula C13H15BrN2O2S2 and a molecular weight of 375.31 g/mol. Its IUPAC name is 3-amino-5-bromo-2-methyl-N-(2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 3-amino-5-bromo-2-methyl-N-(2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114379338 |
| Molecular Formula | C13H15BrN2O2S2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 373.98 |
| IUPAC Name | 3-amino-5-bromo-2-methyl-N-(2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | Cc1c(N)cc(Br)cc1S(=O)(=O)NCCc1ccsc1 |
| InChI | InChI=1S/C13H15BrN2O2S2/c1-9-12(15)6-11(14)7-13(9)20(17,18)16-4-2-10-3-5-19-8-10/h3,5-8,16H,2,4,15H2,1H3 |
| InChIKey | VNKZMRHAVBBZOU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|