C10H12N2O2S3 — CID 54953251
4-amino-N-(2-thiophen-3-ylethyl)thiophene-2-sulfonamide (PubChem CID 54953251) has the molecular formula C10H12N2O2S3 and a molecular weight of 288.42 g/mol. Its IUPAC name is 4-amino-N-(2-thiophen-3-ylethyl)thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-(2-thiophen-3-ylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54953251 |
| Molecular Formula | C10H12N2O2S3 |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 4-amino-N-(2-thiophen-3-ylethyl)thiophene-2-sulfonamide |
| SMILES | Nc1csc(S(=O)(=O)NCCc2ccsc2)c1 |
| InChI | InChI=1S/C10H12N2O2S3/c11-9-5-10(16-7-9)17(13,14)12-3-1-8-2-4-15-6-8/h2,4-7,12H,1,3,11H2 |
| InChIKey | GDXZZNPTYPNFOL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |