C7H13N3O4S3 — CID 61299780
4-amino-N-[2-(methanesulfonamido)ethyl]thiophene-2-sulfonamide (PubChem CID 61299780) has the molecular formula C7H13N3O4S3 and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-amino-N-[2-(methanesulfonamido)ethyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[2-(methanesulfonamido)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61299780 |
| Molecular Formula | C7H13N3O4S3 |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | 4-amino-N-[2-(methanesulfonamido)ethyl]thiophene-2-sulfonamide |
| SMILES | CS(=O)(=O)NCCNS(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C7H13N3O4S3/c1-16(11,12)9-2-3-10-17(13,14)7-4-6(8)5-15-7/h4-5,9-10H,2-3,8H2,1H3 |
| InChIKey | YPSAYYAHJUTCCU-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|