C9H12N4O2S2 — CID 61301349
4-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 61301349) has the molecular formula C9H12N4O2S2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 4-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 61301349 |
| Molecular Formula | C9H12N4O2S2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 4-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1[nH]ncc1CNS(=O)(=O)c1cc(N)cs1 |
| InChI | InChI=1S/C9H12N4O2S2/c1-6-7(3-11-13-6)4-12-17(14,15)9-2-8(10)5-16-9/h2-3,5,12H,4,10H2,1H3,(H,11,13) |
| InChIKey | QOOPNJDQURNNSH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |