C10H13N5O2S — CID 62151905
6-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide (PubChem CID 62151905) has the molecular formula C10H13N5O2S and a molecular weight of 267.31 g/mol. Its IUPAC name is 6-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 6-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62151905 |
| Molecular Formula | C10H13N5O2S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 6-amino-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cc1[nH]ncc1CNS(=O)(=O)c1ccc(N)nc1 |
| InChI | InChI=1S/C10H13N5O2S/c1-7-8(4-13-15-7)5-14-18(16,17)9-2-3-10(11)12-6-9/h2-4,6,14H,5H2,1H3,(H2,11,12)(H,13,15) |
| InChIKey | IUFIWGGEFNPLJU-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |