C10H12N4O2S — CID 54896202
N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide (PubChem CID 54896202) has the molecular formula C10H12N4O2S and a molecular weight of 252.30 g/mol. Its IUPAC name is N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 54896202 |
| Molecular Formula | C10H12N4O2S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cc1[nH]ncc1CNS(=O)(=O)c1cccnc1 |
| InChI | InChI=1S/C10H12N4O2S/c1-8-9(5-12-14-8)6-13-17(15,16)10-3-2-4-11-7-10/h2-5,7,13H,6H2,1H3,(H,12,14) |
| InChIKey | HXZMLPXUFYBQKR-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |