C10H11ClN4O2S — CID 61046336
2-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-4-sulfonamide (PubChem CID 61046336) has the molecular formula C10H11ClN4O2S and a molecular weight of 286.74 g/mol. Its IUPAC name is 2-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61046336 |
| Molecular Formula | C10H11ClN4O2S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 2-chloro-N-[(5-methyl-1H-pyrazol-4-yl)methyl]pyridine-4-sulfonamide |
| SMILES | Cc1[nH]ncc1CNS(=O)(=O)c1ccnc(Cl)c1 |
| InChI | InChI=1S/C10H11ClN4O2S/c1-7-8(5-13-15-7)6-14-18(16,17)9-2-3-12-10(11)4-9/h2-5,14H,6H2,1H3,(H,13,15) |
| InChIKey | HARQHSIVDNPNNK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|