C9H9ClN4O3S — CID 61045796
2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-4-sulfonamide (PubChem CID 61045796) has the molecular formula C9H9ClN4O3S and a molecular weight of 288.72 g/mol. Its IUPAC name is 2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-4-sulfonamide.
| Compound Name | 2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-4-sulfonamide |
|---|---|
| PubChem CID | 61045796 |
| Molecular Formula | C9H9ClN4O3S |
| Molecular Weight | 288.72 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 2-chloro-N-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]pyridine-4-sulfonamide |
| SMILES | Cc1noc(CNS(=O)(=O)c2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C9H9ClN4O3S/c1-6-13-9(17-14-6)5-12-18(15,16)7-2-3-11-8(10)4-7/h2-4,12H,5H2,1H3 |
| InChIKey | ITCQEOYOIHWCJL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.72 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|