C11H10IN3O5S — CID 103962380
2-iodo-5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoic acid (PubChem CID 103962380) has the molecular formula C11H10IN3O5S and a molecular weight of 423.19 g/mol. Its IUPAC name is 2-iodo-5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 2-iodo-5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 103962380 |
| Molecular Formula | C11H10IN3O5S |
| Molecular Weight | 423.19 g/mol |
| Exact Mass | 422.94 |
| IUPAC Name | 2-iodo-5-[(3-methyl-1,2,4-oxadiazol-5-yl)methylsulfamoyl]benzoic acid |
| SMILES | Cc1noc(CNS(=O)(=O)c2ccc(I)c(C(=O)O)c2)n1 |
| InChI | InChI=1S/C11H10IN3O5S/c1-6-14-10(20-15-6)5-13-21(18,19)7-2-3-9(12)8(4-7)11(16)17/h2-4,13H,5H2,1H3,(H,16,17) |
| InChIKey | HXVBWPSUKKDIAC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|