C12H9BrINO4S2 — CID 103962540
5-[(4-bromothiophen-2-yl)methylsulfamoyl]-2-iodobenzoic acid (PubChem CID 103962540) has the molecular formula C12H9BrINO4S2 and a molecular weight of 502.15 g/mol. Its IUPAC name is 5-[(4-bromothiophen-2-yl)methylsulfamoyl]-2-iodobenzoic acid.
| Compound Name | 5-[(4-bromothiophen-2-yl)methylsulfamoyl]-2-iodobenzoic acid |
|---|---|
| PubChem CID | 103962540 |
| Molecular Formula | C12H9BrINO4S2 |
| Molecular Weight | 502.15 g/mol |
| Exact Mass | 500.82 |
| IUPAC Name | 5-[(4-bromothiophen-2-yl)methylsulfamoyl]-2-iodobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2cc(Br)cs2)ccc1I |
| InChI | InChI=1S/C12H9BrINO4S2/c13-7-3-8(20-6-7)5-15-21(18,19)9-1-2-11(14)10(4-9)12(16)17/h1-4,6,15H,5H2,(H,16,17) |
| InChIKey | IJIIZALDBVRANL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|