C12H16INO5S — CID 107316572
5-(5-hydroxypentylsulfamoyl)-2-iodobenzoic acid (PubChem CID 107316572) has the molecular formula C12H16INO5S and a molecular weight of 413.23 g/mol. Its IUPAC name is 5-(5-hydroxypentylsulfamoyl)-2-iodobenzoic acid.
| Compound Name | 5-(5-hydroxypentylsulfamoyl)-2-iodobenzoic acid |
|---|---|
| PubChem CID | 107316572 |
| Molecular Formula | C12H16INO5S |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 5-(5-hydroxypentylsulfamoyl)-2-iodobenzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCCCCCO)ccc1I |
| InChI | InChI=1S/C12H16INO5S/c13-11-5-4-9(8-10(11)12(16)17)20(18,19)14-6-2-1-3-7-15/h4-5,8,14-15H,1-3,6-7H2,(H,16,17) |
| InChIKey | CMHGJYAXKIXEGU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|