C10H13N3O2S2 — CID 54896671
5-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide (PubChem CID 54896671) has the molecular formula C10H13N3O2S2 and a molecular weight of 271.37 g/mol. Its IUPAC name is 5-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 54896671 |
| Molecular Formula | C10H13N3O2S2 |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 5-methyl-N-[(5-methyl-1H-pyrazol-4-yl)methyl]thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2cn[nH]c2C)s1 |
| InChI | InChI=1S/C10H13N3O2S2/c1-7-3-4-10(16-7)17(14,15)12-6-9-5-11-13-8(9)2/h3-5,12H,6H2,1-2H3,(H,11,13) |
| InChIKey | SNEYGCMRZIEPDG-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |