C11H15N3S — CID 60761461
N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-(5-methylthiophen-2-yl)methanamine (PubChem CID 60761461) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-(5-methylthiophen-2-yl)methanamine.
| Compound Name | N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-(5-methylthiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 60761461 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-(5-methylthiophen-2-yl)methanamine |
| SMILES | Cc1ccc(CNCc2cn[nH]c2C)s1 |
| InChI | InChI=1S/C11H15N3S/c1-8-3-4-11(15-8)7-12-5-10-6-13-14-9(10)2/h3-4,6,12H,5,7H2,1-2H3,(H,13,14) |
| InChIKey | DMVOZWYXGJDWGY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |