C13H14F3N3 — CID 86776389
N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 86776389) has the molecular formula C13H14F3N3 and a molecular weight of 269.27 g/mol. Its IUPAC name is N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 86776389 |
| Molecular Formula | C13H14F3N3 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[(5-methyl-1H-pyrazol-4-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1[nH]ncc1CNCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14F3N3/c1-9-11(8-18-19-9)7-17-6-10-2-4-12(5-3-10)13(14,15)16/h2-5,8,17H,6-7H2,1H3,(H,18,19) |
| InChIKey | IVZLTKBBDNQGFM-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |