C16H13F6N — CID 594666
1-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine (PubChem CID 594666) has the molecular formula C16H13F6N and a molecular weight of 333.28 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine |
|---|---|
| PubChem CID | 594666 |
| Molecular Formula | C16H13F6N |
| Molecular Weight | 333.28 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-N-[[4-(trifluoromethyl)phenyl]methyl]methanamine |
| SMILES | FC(F)(F)c1ccc(CNCc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H13F6N/c17-15(18,19)13-5-1-11(2-6-13)9-23-10-12-3-7-14(8-4-12)16(20,21)22/h1-8,23H,9-10H2 |
| InChIKey | RTYCLZDMKHLTTA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.28 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |