C15H12F6N2 — CID 169111944
1-[4-(trifluoromethyl)phenyl]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]methanamine (PubChem CID 169111944) has the molecular formula C15H12F6N2 and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)phenyl]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]methanamine.
| Compound Name | 1-[4-(trifluoromethyl)phenyl]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]methanamine |
|---|---|
| PubChem CID | 169111944 |
| Molecular Formula | C15H12F6N2 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 1-[4-(trifluoromethyl)phenyl]-N-[[6-(trifluoromethyl)-3-pyridinyl]methyl]methanamine |
| SMILES | FC(F)(F)c1ccc(CNCc2ccc(C(F)(F)F)nc2)cc1 |
| InChI | InChI=1S/C15H12F6N2/c16-14(17,18)12-4-1-10(2-5-12)7-22-8-11-3-6-13(23-9-11)15(19,20)21/h1-6,9,22H,7-8H2 |
| InChIKey | ZDXSHFSYYLMFFV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |