C13H13ClF3N3 — CID 60702101
N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine (PubChem CID 60702101) has the molecular formula C13H13ClF3N3 and a molecular weight of 303.72 g/mol. Its IUPAC name is N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 60702101 |
| Molecular Formula | C13H13ClF3N3 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | N-[(5-chloro-1-methylimidazol-2-yl)methyl]-1-[4-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cn1c(Cl)cnc1CNCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13ClF3N3/c1-20-11(14)7-19-12(20)8-18-6-9-2-4-10(5-3-9)13(15,16)17/h2-5,7,18H,6,8H2,1H3 |
| InChIKey | HLHMRDHWMXJPTE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |