C12H10Cl2F3N3 — CID 43217289
2-chloro-N-[(5-chloro-1-methylimidazol-2-yl)methyl]-5-(trifluoromethyl)aniline (PubChem CID 43217289) has the molecular formula C12H10Cl2F3N3 and a molecular weight of 324.13 g/mol. Its IUPAC name is 2-chloro-N-[(5-chloro-1-methylimidazol-2-yl)methyl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-chloro-N-[(5-chloro-1-methylimidazol-2-yl)methyl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43217289 |
| Molecular Formula | C12H10Cl2F3N3 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 2-chloro-N-[(5-chloro-1-methylimidazol-2-yl)methyl]-5-(trifluoromethyl)aniline |
| SMILES | Cn1c(Cl)cnc1CNc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C12H10Cl2F3N3/c1-20-10(14)5-19-11(20)6-18-9-4-7(12(15,16)17)2-3-8(9)13/h2-5,18H,6H2,1H3 |
| InChIKey | SOYSWORSAYKMDO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |