C16H19N5 — CID 86808687
1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]methanamine (PubChem CID 86808687) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]methanamine.
| Compound Name | 1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 86808687 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-methyl-1H-pyrazol-4-yl)methyl]methanamine |
| SMILES | Cc1[nH]ncc1CNCc1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C16H19N5/c1-13-16(10-19-20-13)9-18-8-14-2-4-15(5-3-14)11-21-7-6-17-12-21/h2-7,10,12,18H,8-9,11H2,1H3,(H,19,20) |
| InChIKey | ZQOWLDAARHBXBV-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |