1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen

C11H20N2 — CID 167543192

IUPAC1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen
SMILESCc1ccc(Cn2ccnc2)cc1.[H][H].[H][H].[H][H].[H][H]
InChIInChI=1S/C11H12N2.4H2/c1-10-2-4-11(5-3-10)8-13-7-6-12-9-13;;;;/h2-7,9H,8H2,1H3;4*1H
InChIKeyBLPMLOGVPYTXBD-UHFFFAOYSA-N
MW180.30 g/mol
LogP3.22
Rot. Bonds2

About 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen

1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen (PubChem CID 167543192) has the molecular formula C11H20N2 and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen.

Molecular Properties

Compound Name1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen
PubChem CID167543192
Molecular FormulaC11H20N2
Molecular Weight180.30 g/mol
Exact Mass180.16
IUPAC Name1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen
SMILESCc1ccc(Cn2ccnc2)cc1.[H][H].[H][H].[H][H].[H][H]
InChIInChI=1S/C11H12N2.4H2/c1-10-2-4-11(5-3-10)8-13-7-6-12-9-13;;;;/h2-7,9H,8H2,1H3;4*1H
InChIKeyBLPMLOGVPYTXBD-UHFFFAOYSA-N
XLogP3.22
TPSA17.82 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.30
LogP ≤ 53.22
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen?
The IUPAC name of 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen (CID 167543192) is 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen.
What is the SMILES notation for 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen?
The canonical SMILES for 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen is Cc1ccc(Cn2ccnc2)cc1.[H][H].[H][H].[H][H].[H][H].
What is the InChIKey of 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen?
The InChIKey is BLPMLOGVPYTXBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2.4H2/c1-10-2-4-11(5-3-10)8-13-7-6-12-9-13;;;;/h2-7,9H,8H2,1H3;4*1H.
What are the key properties of 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen?
1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen has a molecular weight of 180.30 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-methylphenyl)methyl]imidazole;molecular hydrogen is sourced from PubChem (CID 167543192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).