About 1-benzylimidazole;chloro hypochlorite;selane
1-benzylimidazole;chloro hypochlorite;selane (PubChem CID 175250503) has the molecular formula C10H12Cl2N2OSe
and a molecular weight of 326.09 g/mol. Its IUPAC name is 1-benzylimidazole;chloro hypochlorite;selane.
Molecular Properties
| Compound Name | 1-benzylimidazole;chloro hypochlorite;selane |
| PubChem CID | 175250503 |
| Molecular Formula | C10H12Cl2N2OSe |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 1-benzylimidazole;chloro hypochlorite;selane |
| SMILES | ClOCl.[SeH2].c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C10H10N2.Cl2O.H2Se/c1-2-4-10(5-3-1)8-12-7-6-11-9-12;1-3-2;/h1-7,9H,8H2;;1H2 |
| InChIKey | KYTXGGJECOQWCF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylimidazole;chloro hypochlorite;selane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylimidazole;chloro hypochlorite;selane?
The IUPAC name of 1-benzylimidazole;chloro hypochlorite;selane (CID 175250503) is 1-benzylimidazole;chloro hypochlorite;selane.
What is the SMILES notation for 1-benzylimidazole;chloro hypochlorite;selane?
The canonical SMILES for 1-benzylimidazole;chloro hypochlorite;selane is ClOCl.[SeH2].c1ccc(Cn2ccnc2)cc1.
What is the InChIKey of 1-benzylimidazole;chloro hypochlorite;selane?
The InChIKey is KYTXGGJECOQWCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.Cl2O.H2Se/c1-2-4-10(5-3-1)8-12-7-6-11-9-12;1-3-2;/h1-7,9H,8H2;;1H2.
What are the key properties of 1-benzylimidazole;chloro hypochlorite;selane?
1-benzylimidazole;chloro hypochlorite;selane has a molecular weight of 326.09 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylimidazole;chloro hypochlorite;selane is sourced from PubChem (CID 175250503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).