About benzaldehyde;1-benzylimidazole
benzaldehyde;1-benzylimidazole (PubChem CID 23446402) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is benzaldehyde;1-benzylimidazole.
Molecular Properties
| Compound Name | benzaldehyde;1-benzylimidazole |
| PubChem CID | 23446402 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | benzaldehyde;1-benzylimidazole |
| SMILES | O=Cc1ccccc1.c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C10H10N2.C7H6O/c1-2-4-10(5-3-1)8-12-7-6-11-9-12;8-6-7-4-2-1-3-5-7/h1-7,9H,8H2;1-6H |
| InChIKey | CRDNNERKBLJWDC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;1-benzylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;1-benzylimidazole?
The IUPAC name of benzaldehyde;1-benzylimidazole (CID 23446402) is benzaldehyde;1-benzylimidazole.
What is the SMILES notation for benzaldehyde;1-benzylimidazole?
The canonical SMILES for benzaldehyde;1-benzylimidazole is O=Cc1ccccc1.c1ccc(Cn2ccnc2)cc1.
What is the InChIKey of benzaldehyde;1-benzylimidazole?
The InChIKey is CRDNNERKBLJWDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2.C7H6O/c1-2-4-10(5-3-1)8-12-7-6-11-9-12;8-6-7-4-2-1-3-5-7/h1-7,9H,8H2;1-6H.
What are the key properties of benzaldehyde;1-benzylimidazole?
benzaldehyde;1-benzylimidazole has a molecular weight of 264.33 g/mol, XLogP of 3.43, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;1-benzylimidazole is sourced from PubChem (CID 23446402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).