C21H21N5 — CID 51114927
1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]methanamine (PubChem CID 51114927) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]methanamine.
| Compound Name | 1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 51114927 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[4-(imidazol-1-ylmethyl)phenyl]-N-[(5-phenyl-1H-pyrazol-4-yl)methyl]methanamine |
| SMILES | c1ccc(-c2[nH]ncc2CNCc2ccc(Cn3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C21H21N5/c1-2-4-19(5-3-1)21-20(14-24-25-21)13-23-12-17-6-8-18(9-7-17)15-26-11-10-22-16-26/h1-11,14,16,23H,12-13,15H2,(H,24,25) |
| InChIKey | TVASVAYSZOAEFO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |