C20H20N6 — CID 86808450
1-[4-(pyrazol-1-ylmethyl)phenyl]-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine (PubChem CID 86808450) has the molecular formula C20H20N6 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-[4-(pyrazol-1-ylmethyl)phenyl]-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine.
| Compound Name | 1-[4-(pyrazol-1-ylmethyl)phenyl]-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 86808450 |
| Molecular Formula | C20H20N6 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[4-(pyrazol-1-ylmethyl)phenyl]-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine |
| SMILES | c1cncc(-c2[nH]ncc2CNCc2ccc(Cn3cccn3)cc2)c1 |
| InChI | InChI=1S/C20H20N6/c1-3-18(12-21-8-1)20-19(14-23-25-20)13-22-11-16-4-6-17(7-5-16)15-26-10-2-9-24-26/h1-10,12,14,22H,11,13,15H2,(H,23,25) |
| InChIKey | FKXZPTXAMAJRIX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |