C12H14N4O2 — CID 43756904
methyl 2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]acetate (PubChem CID 43756904) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is methyl 2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]acetate.
| Compound Name | methyl 2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]acetate |
|---|---|
| PubChem CID | 43756904 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | methyl 2-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methylamino]acetate |
| SMILES | COC(=O)CNCc1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C12H14N4O2/c1-18-11(17)8-14-6-10-7-15-16-12(10)9-3-2-4-13-5-9/h2-5,7,14H,6,8H2,1H3,(H,15,16) |
| InChIKey | KOADIEMKPIGMPM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |