C16H15BrN4 — CID 61402124
1-(2-bromophenyl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine (PubChem CID 61402124) has the molecular formula C16H15BrN4 and a molecular weight of 343.23 g/mol. Its IUPAC name is 1-(2-bromophenyl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine.
| Compound Name | 1-(2-bromophenyl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine |
|---|---|
| PubChem CID | 61402124 |
| Molecular Formula | C16H15BrN4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 1-(2-bromophenyl)-N-[(5-pyridin-3-yl-1H-pyrazol-4-yl)methyl]methanamine |
| SMILES | Brc1ccccc1CNCc1cn[nH]c1-c1cccnc1 |
| InChI | InChI=1S/C16H15BrN4/c17-15-6-2-1-4-12(15)8-19-10-14-11-20-21-16(14)13-5-3-7-18-9-13/h1-7,9,11,19H,8,10H2,(H,20,21) |
| InChIKey | RWSOWTNXZPXWPF-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |