C19H22ClN3O2 — CID 51114924
5-[[[4-(imidazol-1-ylmethyl)phenyl]methylamino]methyl]-2-methoxyphenol;hydrochloride (PubChem CID 51114924) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 5-[[[4-(imidazol-1-ylmethyl)phenyl]methylamino]methyl]-2-methoxyphenol;hydrochloride.
| Compound Name | 5-[[[4-(imidazol-1-ylmethyl)phenyl]methylamino]methyl]-2-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 51114924 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 5-[[[4-(imidazol-1-ylmethyl)phenyl]methylamino]methyl]-2-methoxyphenol;hydrochloride |
| SMILES | COc1ccc(CNCc2ccc(Cn3ccnc3)cc2)cc1O.Cl |
| InChI | InChI=1S/C19H21N3O2.ClH/c1-24-19-7-6-17(10-18(19)23)12-21-11-15-2-4-16(5-3-15)13-22-9-8-20-14-22;/h2-10,14,21,23H,11-13H2,1H3;1H |
| InChIKey | QUXVFLPHVIRVKY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |