C12H15N3O2 — CID 60664482
4-[(2-imidazol-1-ylethylamino)methyl]benzene-1,2-diol (PubChem CID 60664482) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-[(2-imidazol-1-ylethylamino)methyl]benzene-1,2-diol.
| Compound Name | 4-[(2-imidazol-1-ylethylamino)methyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 60664482 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 4-[(2-imidazol-1-ylethylamino)methyl]benzene-1,2-diol |
| SMILES | Oc1ccc(CNCCn2ccnc2)cc1O |
| InChI | InChI=1S/C12H15N3O2/c16-11-2-1-10(7-12(11)17)8-13-3-5-15-6-4-14-9-15/h1-2,4,6-7,9,13,16-17H,3,5,8H2 |
| InChIKey | OAWQJCCFPUZEHB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|