C13H13FN4 — CID 114012111
2-fluoro-5-[(2-imidazol-1-ylethylamino)methyl]benzonitrile (PubChem CID 114012111) has the molecular formula C13H13FN4 and a molecular weight of 244.27 g/mol. Its IUPAC name is 2-fluoro-5-[(2-imidazol-1-ylethylamino)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(2-imidazol-1-ylethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 114012111 |
| Molecular Formula | C13H13FN4 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 2-fluoro-5-[(2-imidazol-1-ylethylamino)methyl]benzonitrile |
| SMILES | N#Cc1cc(CNCCn2ccnc2)ccc1F |
| InChI | InChI=1S/C13H13FN4/c14-13-2-1-11(7-12(13)8-15)9-16-3-5-18-6-4-17-10-18/h1-2,4,6-7,10,16H,3,5,9H2 |
| InChIKey | HLFMUAZOTQSWND-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|