C15H20N4O — CID 139020115
3-[(2-imidazol-1-ylethylamino)methyl]-N,N-dimethylbenzamide (PubChem CID 139020115) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 3-[(2-imidazol-1-ylethylamino)methyl]-N,N-dimethylbenzamide.
| Compound Name | 3-[(2-imidazol-1-ylethylamino)methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 139020115 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 3-[(2-imidazol-1-ylethylamino)methyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(CNCCn2ccnc2)c1 |
| InChI | InChI=1S/C15H20N4O/c1-18(2)15(20)14-5-3-4-13(10-14)11-16-6-8-19-9-7-17-12-19/h3-5,7,9-10,12,16H,6,8,11H2,1-2H3 |
| InChIKey | AOQCWRXPKGWDIM-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|