C15H21N5O — CID 82992923
3-amino-4-(3-imidazol-1-ylpropylamino)-N,N-dimethylbenzamide (PubChem CID 82992923) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 3-amino-4-(3-imidazol-1-ylpropylamino)-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-(3-imidazol-1-ylpropylamino)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 82992923 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 3-amino-4-(3-imidazol-1-ylpropylamino)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NCCCn2ccnc2)c(N)c1 |
| InChI | InChI=1S/C15H21N5O/c1-19(2)15(21)12-4-5-14(13(16)10-12)18-6-3-8-20-9-7-17-11-20/h4-5,7,9-11,18H,3,6,8,16H2,1-2H3 |
| InChIKey | VZQDMANHNCPELZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|