C12H17F2N3O2 — CID 106167628
3-amino-4-[(2,2-difluoro-3-hydroxypropyl)amino]-N,N-dimethylbenzamide (PubChem CID 106167628) has the molecular formula C12H17F2N3O2 and a molecular weight of 273.28 g/mol. Its IUPAC name is 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 106167628 |
| Molecular Formula | C12H17F2N3O2 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 3-amino-4-[(2,2-difluoro-3-hydroxypropyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(NCC(F)(F)CO)c(N)c1 |
| InChI | InChI=1S/C12H17F2N3O2/c1-17(2)11(19)8-3-4-10(9(15)5-8)16-6-12(13,14)7-18/h3-5,16,18H,6-7,15H2,1-2H3 |
| InChIKey | WOYOURUMZXMLLC-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|