C13H21N3O3 — CID 66169478
4-amino-3-[(2,3-dihydroxy-2-methylpropyl)amino]-N,N-dimethylbenzamide (PubChem CID 66169478) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-amino-3-[(2,3-dihydroxy-2-methylpropyl)amino]-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-[(2,3-dihydroxy-2-methylpropyl)amino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 66169478 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 4-amino-3-[(2,3-dihydroxy-2-methylpropyl)amino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(NCC(C)(O)CO)c1 |
| InChI | InChI=1S/C13H21N3O3/c1-13(19,8-17)7-15-11-6-9(4-5-10(11)14)12(18)16(2)3/h4-6,15,17,19H,7-8,14H2,1-3H3 |
| InChIKey | HUKKWXHZKUSRBS-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|