C16H18ClN3O — CID 63361074
4-amino-3-[(4-chlorophenyl)methylamino]-N,N-dimethylbenzamide (PubChem CID 63361074) has the molecular formula C16H18ClN3O and a molecular weight of 303.79 g/mol. Its IUPAC name is 4-amino-3-[(4-chlorophenyl)methylamino]-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-[(4-chlorophenyl)methylamino]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 63361074 |
| Molecular Formula | C16H18ClN3O |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-amino-3-[(4-chlorophenyl)methylamino]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H18ClN3O/c1-20(2)16(21)12-5-8-14(18)15(9-12)19-10-11-3-6-13(17)7-4-11/h3-9,19H,10,18H2,1-2H3 |
| InChIKey | UZYLPOYDCYVXLR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|