C15H19N3O2 — CID 63358984
4-amino-N,N-dimethyl-3-[(5-methylfuran-2-yl)methylamino]benzamide (PubChem CID 63358984) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-[(5-methylfuran-2-yl)methylamino]benzamide.
| Compound Name | 4-amino-N,N-dimethyl-3-[(5-methylfuran-2-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 63358984 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-[(5-methylfuran-2-yl)methylamino]benzamide |
| SMILES | Cc1ccc(CNc2cc(C(=O)N(C)C)ccc2N)o1 |
| InChI | InChI=1S/C15H19N3O2/c1-10-4-6-12(20-10)9-17-14-8-11(5-7-13(14)16)15(19)18(2)3/h4-8,17H,9,16H2,1-3H3 |
| InChIKey | ULBIGHDVULLOKU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 71.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|