C12H13ClN2O — CID 115468900
4-chloro-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine (PubChem CID 115468900) has the molecular formula C12H13ClN2O and a molecular weight of 236.70 g/mol. Its IUPAC name is 4-chloro-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine.
| Compound Name | 4-chloro-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine |
|---|---|
| PubChem CID | 115468900 |
| Molecular Formula | C12H13ClN2O |
| Molecular Weight | 236.70 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 4-chloro-2-N-[(5-methylfuran-2-yl)methyl]benzene-1,2-diamine |
| SMILES | Cc1ccc(CNc2cc(Cl)ccc2N)o1 |
| InChI | InChI=1S/C12H13ClN2O/c1-8-2-4-10(16-8)7-15-12-6-9(13)3-5-11(12)14/h2-6,15H,7,14H2,1H3 |
| InChIKey | GRGHAVYYENSACL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.70 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|