C13H16N2O — CID 62523846
2-methyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-diamine (PubChem CID 62523846) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-methyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-diamine.
| Compound Name | 2-methyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 62523846 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 2-methyl-4-N-[(5-methylfuran-2-yl)methyl]benzene-1,4-diamine |
| SMILES | Cc1ccc(CNc2ccc(N)c(C)c2)o1 |
| InChI | InChI=1S/C13H16N2O/c1-9-7-11(4-6-13(9)14)15-8-12-5-3-10(2)16-12/h3-7,15H,8,14H2,1-2H3 |
| InChIKey | MVFVUHKBQNLKAC-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 51.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|